75140-07-7 Usage
Description
4-(4-HYDROXYANILINO)-1,2-DIHYDRONAPHTHALENE-1,2-DIONE is a chemical compound with the molecular formula C20H15NO3. It is a derivative of 1,2-dihydronaphthalene-1,2-dione with a hydroxyanilino group attached at the fourth position. 4-(4-HYDROXYANILINO)-1,2-DIHYDRONAPHTHALENE-1,2-DIONE has potential applications in the field of organic synthesis and medicinal chemistry, where it can be used as a building block for the synthesis of various pharmaceuticals and bioactive compounds. Its structural features make it an interesting molecule for further research and development in the pharmaceutical industry. Additionally, it may also have potential uses in the fields of dyes and pigments, due to its aromatic structure and potential color-inducing properties.
Uses
Used in Organic Synthesis:
4-(4-HYDROXYANILINO)-1,2-DIHYDRONAPHTHALENE-1,2-DIONE is used as a building block for the synthesis of various pharmaceuticals and bioactive compounds. Its unique structure allows for the creation of new molecules with potential therapeutic properties.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-(4-HYDROXYANILINO)-1,2-DIHYDRONAPHTHALENE-1,2-DIONE is used as a starting material for the development of new drugs. Its structural features make it a promising candidate for the design and synthesis of novel therapeutic agents.
Used in Dyes and Pigments Industry:
4-(4-HYDROXYANILINO)-1,2-DIHYDRONAPHTHALENE-1,2-DIONE is used as a potential color-inducing agent in the dyes and pigments industry. Its aromatic structure and potential color properties make it a candidate for the development of new dyes and pigments with unique characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 75140-07-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,1,4 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 75140-07:
(7*7)+(6*5)+(5*1)+(4*4)+(3*0)+(2*0)+(1*7)=107
107 % 10 = 7
So 75140-07-7 is a valid CAS Registry Number.
InChI:InChI=1/C16H11NO3/c18-11-7-5-10(6-8-11)17-14-9-15(19)16(20)13-4-2-1-3-12(13)14/h1-9,17-18H
75140-07-7Relevant articles and documents
Synthesis of Substituted 4-Arylamino-1,2-naphthoquinones in One-Pot Reactions Using CotA-Laccase as Biocatalyst
Sousa, Ana Catarina,Santos, Iolanda,Piedade,Martins, Lígia O.,Robalo, M. Paula
, p. 3380 - 3387 (2020/05/18)
An efficient and environmentally benign biocatalytic strategy for the synthesis of substituted 4-arylamino-1,2-naphthoquinones was developed, through a cross-coupling reaction in which the 1,2-naphthoquinone nucleus, formed in the biocatalytic process mediated by CotA-laccase from Bacillus subtilis, is the key synthetic intermediate. Electrochemical data and kinetic parameters were determined revealing a significant higher specificity of CotA-laccase for 4-amino-3-hydroxynaphthalene-1-sulfonic acid (AHNSA). This ability of CotA-laccase to discriminate between oxidisable aromatic amines allows the set-up of one-pot reactions in the presence of the enzyme, between AHNSA and a set of appropriate aromatic amines under mild reaction conditions. (Figure presented.).