5908-27-0 Usage
Description
POTASSIUM 1,2-NAPHTHOQUINONE-4-SULFONIC ACID, also known as 1,2-Naphthoquinone-4-sulfonic acid potassium salt, is an organic compound with the chemical formula C10H5KO5S. It is characterized by its orange fluffy powder appearance and is known for its utility in various chemical processes.
Uses
Used in Chemical Synthesis:
POTASSIUM 1,2-NAPHTHOQUINONE-4-SULFONIC ACID is used as a reagent for the synthesis of various compounds, particularly fluorescent phenazines. Its unique chemical properties make it a valuable component in the creation of these substances.
Used in Characterization:
POTASSIUM 1,2-NAPHTHOQUINONE-4-SULFONIC ACID is also utilized in the characterization of different materials, allowing for a better understanding of their properties and potential applications.
Used in Photophysical Examination:
POTASSIUM 1,2-NAPHTHOQUINONE-4-SULFONIC ACID is employed in the photophysical examination of fluorescent phenazines, helping to study their light absorption and emission characteristics, which are crucial for their performance in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5908-27-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,0 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5908-27:
(6*5)+(5*9)+(4*0)+(3*8)+(2*2)+(1*7)=110
110 % 10 = 0
So 5908-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C26H22ClN3O2/c27-21-12-10-18(11-13-21)16-24(30-25(31)19-6-2-1-3-7-19)26(32)28-15-14-20-17-29-23-9-5-4-8-22(20)23/h1-13,16-17,29H,14-15H2,(H,28,32)(H,30,31)/b24-16-