112913-94-7 Usage
Description
2-Acetylamidomethyl-4-(4-fluorobenzyl)morpholine is a morpholine derivative that serves as a synthetic intermediate in the production of pharmaceuticals and agrochemicals. This chemical compound features an acetyl group, an amide group, a benzyl group, and a unique fluorobenzyl group, which contribute to its potential biological activity and interactions with various biological targets. Its morpholine ring structure further enhances its suitability for drug design and discovery, making it a valuable building block in the synthesis of diverse drugs.
Uses
Used in Pharmaceutical Industry:
2-Acetylamidomethyl-4-(4-fluorobenzyl)morpholine is used as a synthetic intermediate for the development of various pharmaceuticals. Its unique chemical structure allows it to be a building block in the synthesis of drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Acetylamidomethyl-4-(4-fluorobenzyl)morpholine is utilized as a synthetic intermediate for the production of agrochemicals. Its chemical properties make it a valuable component in the development of effective and targeted agrochemical products.
Used in Medicinal Chemistry Research:
2-Acetylamidomethyl-4-(4-fluorobenzyl)morpholine is employed as a useful tool in medicinal chemistry research. Its unique chemical structure and potential biological activity make it an attractive candidate for studying and understanding the interactions between chemical compounds and biological targets, ultimately contributing to the advancement of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 112913-94-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,9,1 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 112913-94:
(8*1)+(7*1)+(6*2)+(5*9)+(4*1)+(3*3)+(2*9)+(1*4)=107
107 % 10 = 7
So 112913-94-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H19FN2O2/c1-11(18)16-8-14-10-17(6-7-19-14)9-12-2-4-13(15)5-3-12/h2-5,14H,6-10H2,1H3,(H,16,18)
112913-94-7Relevant articles and documents
Synthesis and biological activity of 4-amino-5-chloro-2-ethoxy-3- hydroxybenzamides, metabolites of a new gastroprokinetic agent, mosapride
Kato, Shiro,Morie, Toshiya,Yoshida, Naoyuki
, p. 1484 - 1492 (2007/10/03)
To confirm the proposed structures of the minor metabolites of a potential gastroprokinetic agent, mosapride, 4-amino-5-chloro-2-ethoxy-3- hydroxy-N-(2-morpholinylmethyl)benzamide (3) and the N-(5-oxo-2- morpholinyl)methyl analogue 4 were prepared. As the
Substituted benzamide derivatives, for enhancing gastrointestinal motility
-
, (2008/06/13)
Compounds of the formula: STR1 wherein R is hydrogen, alkoxycarbonyl, benzyloxycarbonyl, heteroarylalkyl, phenylalkenyl, or --T--(Y)p --R6 (wherein T is single bond or alkylene, Y is oxygen, sulfur or carbonyl, R6 is phenyl, substituted phenyl, naphthyl, or diphenylmethyl, and p is 0 or 1, provided that when T is single bond, p is 0); R1 is halogen, hydroxy, alkoxy, cycloalkyloxy, alkenyloxy, alkynyloxy, alkoxy interrupted by oxygen or carbonyl, alkylthio, amino, monosubstituted amino, or a substituted alkoxy; R2 is hydrogen; R3 is hydrogen, halogen, amino, alkylamino, dialkylamino, alkanoylamino, or nitro; R4 is hydrogen, halogen, nitro, sulfamoyl, alkylsulfamoyl, or dialkylsulfamoyl; or any two adjacent groups of the R1, R2, R3 and R4 may combine to form alkylenedioxy, and the remaining two groups are each hydrogen; R5 is hydrogen or alkyl; X is alkylene; m and n are each 1 or 2; provided that at least one of the groups R2, R3 and R4 is other than hydrogen, and acid addition salts, quaternary ammonium salts and N-oxide derivatives thereof, processes for preparation thereof, and pharmaceutical composition containing the same. Said compounds, salts and N-oxide derivatives thereof show excellent gastrointestinal motility enhancing activity.
