The Levomepromazine hydrochloride, with cas registry number 1236-99-3, has the systematic name of (2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine hydrochloride (1:1). Besides this, it is also called (R)-2-Methoxy-N,N,b-trimethyl-10H-phenothiazine-10-propanamine Hydrochloride. What's more, its EINECS is 214-978-3.

Physical properties about this chemical are: (1)ACD/LogP: 4.94; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 5; (6)Polar Surface Area: 41.01 Å²; (7)Flash Point: 236.8 °C; (8)Enthalpy of Vaporization: 73.01 kJ/mol; (9)Boiling Point: 468 °C at 760 mmHg; (10)Vapour Pressure: 6.22E-09 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Cl.O(c2cc1N(c3c(Sc1cc2)cccc3)C[C@H](C)CN(C)C)C
(2)InChI: InChI=1/C19H24N2OS.ClH/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21;/h5-11,14H,12-13H2,1-4H3;1H/t14-;/m1./s1
(3)InChIKey: ODLGFPIWRAEFAN-PFEQFJNWBU
(4)Std. InChI: InChI=1S/C19H24N2OS.ClH/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21;/h5-11,14H,12-13H2,1-4H3;1H/t14-;/m1./s1
(5)Std. InChIKey: ODLGFPIWRAEFAN-PFEQFJNWSA-N

The toxicity data is as follows: