The 2-Oxiranecarboxylicacid, 2-tetradecyl-, methyl ester, with the CAS registry number 92982-25-7, is also known as 2-Tetradecyl-2-oxiranecarboxylic acid methyl ester. This chemical's molecular formula is C₁₈H₃₄O₃ and molecular weight is 298.46076. Its IUPAC name is called methyl 2-tetradecyloxirane-2-carboxylate.

Physical properties of 2-Oxiranecarboxylicacid, 2-tetradecyl-, methyl ester: (1)ACD/LogP: 6.65; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 6.65; (4)ACD/LogD (pH 7.4): 6.65; (5)ACD/BCF (pH 5.5): 66622.34; (6)ACD/BCF (pH 7.4): 66622.34; (7)ACD/KOC (pH 5.5): 98702.47; (8)ACD/KOC (pH 7.4): 98702.47; (9)#H bond acceptors: 3; (10)#Freely Rotating Bonds: 15; (11)Index of Refraction: 1.46; (12)Molar Refractivity: 86.6 cm³; (13)Molar Volume: 315.9 cm³; (14)Surface Tension: 34.1 dyne/cm; (15)Density: 0.944 g/cm³; (16)Flash Point: 150.9 °C; (17)Enthalpy of Vaporization: 60.73 kJ/mol; (18)Boiling Point: 361.4 °C at 760 mmHg; (19)Vapour Pressure: 2.07E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCCCCCCCCCCCC1(CO1)C(=O)OC
(2)InChI: InChI=1S/C18H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18(16-21-18)17(19)20-2/h3-16H2,1-2H3
(3)InChIKey: RSSDZUNGAWCFPT-UHFFFAOYSA-N