The CAS registry number of 2-(1-Methyl-1H-pyrazol-5-yl)pyridine is 938066-21-8. This chemical's molecular formula is C₉H₉N₃ and molecular weight is 159.1879. Its systematic name is called 2-(1-methyl-1H-pyrazol-5-yl)pyridine.

Physical properties of 2-(1-Methyl-1H-pyrazol-5-yl)pyridine: (1)ACD/LogP: 0.73; (2)ACD/LogD (pH 5.5): 0.69; (3)ACD/LogD (pH 7.4): 0.73; (4)ACD/BCF (pH 5.5): 1.94; (5)ACD/BCF (pH 7.4): 2.11; (6)ACD/KOC (pH 5.5): 54.72; (7)ACD/KOC (pH 7.4): 59.3; (8)#H bond acceptors: 3; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.615; (11)Molar Refractivity: 48.8 cm³; (12)Molar Volume: 139.6 cm³; (13)Surface Tension: 43.3 dyne/cm; (14)Density: 1.13 g/cm³; (15)Flash Point: 132.2 °C; (16)Enthalpy of Vaporization: 51.33 kJ/mol; (17)Boiling Point: 295 °C at 760 mmHg; (18)Vapour Pressure: 0.00276 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: n1ccccc1c2ccnn2C
(2)InChI: InChI=1/C9H9N3/c1-12-9(5-7-11-12)8-4-2-3-6-10-8/h2-7H,1H3
(3)InChIKey: PKAIICPQAWUHEE-UHFFFAOYAA