The CAS registry number of 5-Pyrimidinol,2-methoxy-4,6-dimethyl- is 345642-89-9. This chemical is also known as 5-Hydroxy-2-methoxy-4,6-dimethylpyrimidine. The molecular formula of it is C₇H₁₀N₂O₂ and molecular weight is 154.17. Its systematic name is called 2-methoxy-4,6-dimethylpyrimidin-5-ol.

Physical properties about this chemical are: (1)ACD/LogP: -0.06; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0; (4)ACD/LogD (pH 7.4): 0; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 39; (8)ACD/KOC (pH 7.4): 18; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Index of Refraction: 1.533; (13)Molar Refractivity: 40.645 cm³; (14)Molar Volume: 130.863 cm³; (15)Surface Tension: 46.943 dyne/cm; (16)Density: 1.178 g/cm³; (17)Flash Point: 130.009 °C; (18)Enthalpy of Vaporization: 55.206 kJ/mol; (19)Boiling Point: 291.357 °C at 760 mmHg; (20)Vapour Pressure: 0.001 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O(c1nc(c(O)c(n1)C)C)C
(2)InChI: InChI=1/C7H10N2O2/c1-4-6(10)5(2)9-7(8-4)11-3/h10H,1-3H3
(3)InChIKey: GFHMFYQZOGTSKG-UHFFFAOYAS