The 4-Pyrimidinol,2-methyl-, with the CAS registry number 67383-35-1, is also known as 4(3H)-Pyrimidinone, 2-methyl-. It belongs to the product categoryof Pyrimidine. This chemical's molecular formula is C₅H₆N₂O and molecular weight is 110.11. Its systematic name is called 2-methylpyrimidin-4(3H)-one. 

Physical properties of 4-Pyrimidinol,2-methyl-: (1)ACD/LogP: -0.77; (2)ACD/LogD (pH 5.5): -0.77; (3)ACD/LogD (pH 7.4): -0.77; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 9.07; (7)ACD/KOC (pH 7.4): 9; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)Index of Refraction: 1.576; (11)Molar Refractivity: 29.8 cm³; (12)Molar Volume: 89.9 cm³; (13)Surface Tension: 42.8 dyne/cm; (14)Density: 1.22 g/cm³; (15)Flash Point: 68.9 °C; (16)Enthalpy of Vaporization: 42.65 kJ/mol; (17)Boiling Point: 190.3 °C at 760 mmHg; (18)Vapour Pressure: 0.545 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C1/C=C\N=C(/N1)C
(2)InChI: InChI=1/C5H6N2O/c1-4-6-3-2-5(8)7-4/h2-3H,1H3,(H,6,7,8)
(3)InChIKey: QWIDYOLZFAQBOB-UHFFFAOYAL