The IUPAC name of this chemical is (3S)-3-amino-3-phenylpropanoic acid. With the CAS registry number 40856-44-8, it is also named as Benzenepropanoic acid, β-amino-, (βS)-. The product's categories are 3-Amino-3-phenylpropanoic Acid Analogs; Alcohol Aldehyde & Acid Series; API Intermediates. In addition, the formula is C₉H₁₁NO₂ and the molecular weight is 165.19.

The other characteristics of (S)-3-Amino-3-phenylpropanoic acid can be summarized as: (1)ACD/LogP: 0.91; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 4; (10)Polar Surface Area: 29.54 Å²; (11)Index of Refraction: 1.574; (12)Molar Refractivity: 45.53 cm³; (13)Molar Volume: 137.8 cm³; (14)Polarizability: 18.05×10^-24 cm³; (15)Surface Tension: 53.7 dyne/cm; (16)Density: 1.198 g/cm³; (17)Flash Point: 139.8 °C; (18)Enthalpy of Vaporization: 57.88 kJ/mol; (19)Boiling Point: 307.5 °C at 760 mmHg; (20)Vapour Pressure: 0.000313 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:O=C(O)C[C@H](N)c1ccccc1
2. InChI:InChI=1/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
3. InChIKey:UJOYFRCOTPUKAK-QMMMGPOBBX
4. Std. InChI:InChI=1S/C9H11NO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
5. Std. InChIKey:UJOYFRCOTPUKAK-QMMMGPOBSA-N