93438-27-8 Usage
Uses
Used in Pharmaceutical Industry:
2-ANILINO-4,6-BIS(MORPHOLINO)-1,3,5-TRIAZINE is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential biological activities. Its unique structure allows for the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical field, 2-ANILINO-4,6-BIS(MORPHOLINO)-1,3,5-TRIAZINE is utilized as a precursor for the production of agrochemicals, such as pesticides and herbicides, due to its reactivity and potential to form complex organic compounds with desired properties.
Used in Materials Science:
2-ANILINO-4,6-BIS(MORPHOLINO)-1,3,5-TRIAZINE is employed as a building block in the development of advanced materials with specific properties, such as high thermal stability, flame retardancy, or specific optical characteristics, for use in various applications, including coatings, adhesives, and plastics.
Check Digit Verification of cas no
The CAS Registry Mumber 93438-27-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,4,3 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 93438-27:
(7*9)+(6*3)+(5*4)+(4*3)+(3*8)+(2*2)+(1*7)=148
148 % 10 = 8
So 93438-27-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H22N6O2/c1-2-4-14(5-3-1)18-15-19-16(22-6-10-24-11-7-22)21-17(20-15)23-8-12-25-13-9-23/h1-5H,6-13H2,(H,18,19,20,21)