913835-27-5 Usage
Description
4-Isopropylpyrimidine-5-boronic acid 95, with the molecular formula C8H12BN3O2, is a boronic acid derivative characterized by the presence of a boron atom attached to a pyrimidine ring and an isopropyl group. 4-ISOPROPYLPYRIMIDINE-5-BORONIC ACID 95 is recognized for its role as a building block in organic synthesis, especially in the creation of pharmaceuticals and agrochemicals. The boronic acid group in the molecule is capable of forming reversible covalent bonds with diol-containing molecules, which is advantageous in a range of chemical reactions. The purity level indicated by "95" signifies that the compound is 95% pure, ensuring a high degree of quality for its applications.
Uses
Used in Pharmaceutical Industry:
4-Isopropylpyrimidine-5-boronic acid 95 is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and boronic acid functionality contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Isopropylpyrimidine-5-boronic acid 95 serves as a crucial component in the production of pesticides and other crop protection agents. Its ability to form reversible covalent bonds aids in the design of effective and targeted agrochemicals.
Used in Organic Synthesis:
4-Isopropylpyrimidine-5-boronic acid 95 is employed as a versatile building block in organic synthesis for creating a wide array of chemical compounds. Its reactivity and structural features make it a valuable asset in the synthesis of complex organic molecules.
Used in Chemical Research:
4-ISOPROPYLPYRIMIDINE-5-BORONIC ACID 95 is also used as a research tool in various chemical studies. Its unique properties allow scientists to explore new reaction pathways and mechanisms, potentially leading to the discovery of novel chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 913835-27-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,3,8,3 and 5 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 913835-27:
(8*9)+(7*1)+(6*3)+(5*8)+(4*3)+(3*5)+(2*2)+(1*7)=175
175 % 10 = 5
So 913835-27-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H11BN2O2/c1-5(2)7-6(8(11)12)3-9-4-10-7/h3-5,11-12H,1-2H3
