885068-10-0 Usage
Description
6-INDAZOLYBORONIC ACID is an organic compound that features a boron atom bonded to an indazole ring. It is known for its unique chemical properties and potential applications in various fields, particularly in the synthesis of pharmaceutical compounds and organic synthesis.
Uses
Used in Pharmaceutical Industry:
6-INDAZOLYBORONIC ACID is used as a reactant for the preparation of various pharmaceutical compounds, including:
1. Bicyclic hydroxyphenylmethanone derivatives: These are employed as hydroxysteroid dehydrogenase inhibitors, which play a crucial role in the regulation of steroid hormone metabolism and have potential applications in the treatment of hormone-dependent disorders.
2. Bisphosphonate inhibitors of human farnesyl pyrophosphate synthase: These inhibitors are used to target the enzyme farnesyl pyrophosphate synthase, which is involved in the biosynthesis of cholesterol and other isoprenoid compounds. Inhibition of this enzyme can have therapeutic benefits in the treatment of certain diseases.
3. Indazolyl benzoimidazoles: These compounds act as PKC-ζ inhibitors, targeting the protein kinase C-ζ isoform, which is implicated in various cellular processes, including cell growth, differentiation, and apoptosis. Inhibition of PKC-ζ may have potential applications in the treatment of cancer and other diseases.
4. Pyrazolopyrimidinamine derivatives: These compounds exhibit tyrosine and phosphinositide kinase inhibitory activity, which can be useful in the development of drugs targeting enzymes involved in signal transduction pathways, potentially leading to the treatment of various diseases, including cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 885068-10-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,0,6 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 885068-10:
(8*8)+(7*8)+(6*5)+(5*0)+(4*6)+(3*8)+(2*1)+(1*0)=200
200 % 10 = 0
So 885068-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BN2O2/c11-8(12)6-2-1-5-4-9-10-7(5)3-6/h1-4,11-12H,(H,9,10)
885068-10-0Relevant articles and documents
Micromolecular reversible BTK inhibitor for treating rheumatoid arthritis
-
Paragraph 0140-0141; 0145-0148, (2019/07/29)
The invention relates to a micromolecular reversible BTK inhibitor for treating rheumatoid arthritis, and specifically provides a compound. The compound is the compound as shown in a formula I, or a stereisomer, a geometrical isomer and a tautomer thereof, nitric oxide, aquo-complex, a solvate, a metabolite and pharmaceutically acceptable salts and prodrugs. The inventor finds that polysubstitutedquinolone compound or derivate thereof as shown in formula I can be used as the BTK inhibitor and is high in activity during treating rheumatoid arthritis.