870062-76-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3-fluoro-5-hydroxypyridine is used as a building block in the synthesis of various pharmaceutical drugs. Its unique structure allows for the production of a wide range of functionalized pyridine derivatives, which can be further utilized in the development of new drugs with potential therapeutic applications.
Used in Agricultural Industry:
In the agricultural sector, 2-Chloro-3-fluoro-5-hydroxypyridine is used as a key ingredient in the development of new crop protection products. Its potential applications include the synthesis of agrochemicals that can help protect crops from pests and diseases, thereby contributing to increased agricultural productivity.
As an Intermediate in Organic Synthesis:
2-Chloro-3-fluoro-5-hydroxypyridine is utilized as a valuable intermediate in organic synthesis, enabling the production of a diverse array of functionalized pyridine derivatives. These derivatives can be further modified and incorporated into various chemical compounds, expanding the scope of applications in both pharmaceutical and agricultural industries.
Check Digit Verification of cas no
The CAS Registry Mumber 870062-76-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,7,0,0,6 and 2 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 870062-76:
(8*8)+(7*7)+(6*0)+(5*0)+(4*6)+(3*2)+(2*7)+(1*6)=163
163 % 10 = 3
So 870062-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClFNO/c6-5-4(7)1-3(9)2-8-5/h1-2,9H
