857283-59-1 Usage
Description
1-(3-Isocyanatophenyl)-1H-pyrrole is a chemical compound characterized by the molecular formula C11H8N2O. It is a pyrrole derivative featuring an isocyanate group attached to the phenyl ring. This unique structure and reactivity make it a valuable building block in organic chemistry, with potential applications in the development of new molecules and materials.
Uses
Used in Pharmaceutical Industry:
1-(3-Isocyanatophenyl)-1H-pyrrole is utilized as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of diverse drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(3-Isocyanatophenyl)-1H-pyrrole serves as a crucial component in the development of new agrochemicals. Its reactivity and structural properties contribute to the design of effective compounds for agricultural use.
Used in Materials Science:
1-(3-Isocyanatophenyl)-1H-pyrrole is employed as a versatile building block in the synthesis of advanced materials. Its unique chemical properties enable the development of innovative materials with a range of applications.
Used in Drug Development:
Due to its potential biological activities, including cytotoxic and antiproliferative effects on cancer cells, 1-(3-Isocyanatophenyl)-1H-pyrrole is studied for its role in drug development. It holds promise as a candidate for the creation of novel therapeutic agents targeting cancer and other diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 857283-59-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,2,8 and 3 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 857283-59:
(8*8)+(7*5)+(6*7)+(5*2)+(4*8)+(3*3)+(2*5)+(1*9)=211
211 % 10 = 1
So 857283-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O/c14-9-12-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H
