73956-15-7 Usage
Description
2,2-Diethoxyethanethioamide is an organic compound that serves as a crucial intermediate in the synthesis of Tubulysin M, an antimitotic peptide derived from myxobacteria. It plays a significant role in the development of pharmaceuticals targeting cancer cells by disrupting microtubule dynamics.
Uses
Used in Pharmaceutical Industry:
2,2-Diethoxyethanethioamide is used as a key intermediate in the synthesis of Tubulysin M for its antimitotic properties. Tubulysin M is an effective agent against cancer due to its ability to inhibit microtubule polymerization, leading to cell cycle arrest and apoptosis in cancer cells. This makes 2,2-Diethoxyethanethioamide a valuable component in the development of anticancer drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 73956-15-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,9,5 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 73956-15:
(7*7)+(6*3)+(5*9)+(4*5)+(3*6)+(2*1)+(1*5)=157
157 % 10 = 7
So 73956-15-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2S/c1-3-8-6(5(7)10)9-4-2/h6H,3-4H2,1-2H3,(H2,7,10)