73781-88-1 Usage
Description
2-(Methylthio)-5-pyrimidinecarboxylic acid ethyl ester is a chemical compound characterized by the molecular formula C8H10N2O2S. It is an ethyl ester derivative of pyrimidinecarboxylic acid, featuring a methylthio group attached to the pyrimidine ring. 2-(Methylthio)-5-pyrimidinecarboxylic acid ethyl ester holds potential in the pharmaceutical industry and organic chemistry research, serving as a building block for the synthesis of various chemical compounds.
Uses
Used in Pharmaceutical Industry:
2-(Methylthio)-5-pyrimidinecarboxylic acid ethyl ester is used as a key intermediate in the synthesis of pharmaceutical and medicinal products. Its unique structure and functional groups contribute to the development of new drugs with potential therapeutic applications.
Used in Organic Chemistry Research:
In the field of organic chemistry, 2-(Methylthio)-5-pyrimidinecarboxylic acid ethyl ester serves as a valuable research compound. It can be utilized to explore novel synthetic pathways, reaction mechanisms, and the properties of related compounds, furthering the understanding of organic chemistry and its applications.
Used as a Building Block for Synthesis:
2-(Methylthio)-5-pyrimidinecarboxylic acid ethyl ester is used as a building block in the synthesis of other chemical compounds. Its versatile structure allows for various modifications and functionalizations, enabling the creation of new molecules with diverse properties and potential applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 73781-88-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,3,7,8 and 1 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 73781-88:
(7*7)+(6*3)+(5*7)+(4*8)+(3*1)+(2*8)+(1*8)=161
161 % 10 = 1
So 73781-88-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2S/c1-3-12-7(11)6-4-9-8(13-2)10-5-6/h4-5H,3H2,1-2H3
73781-88-1Relevant articles and documents
DERIVATIVES OF 1-PHENYL-2-PYRIDINYL ALKYL ALCOHOLS AS PHOSPHODIESTERASE INHIBITORS
-
Paragraph 1022, (2013/04/10)
The invention relates to inhibitors of the phosphodiesterase 4 (PDE4) enzyme. More particularly, the invention relates to compounds that are derivatives of 1-phenyl-2-pyridinyl alkyl alcohols, methods of preparing such compounds, compositions containing them and therapeutic use thereof.
