68162-47-0 Usage
Description
4-(Bromomethyl)phenylboronic acid is a white solid chemical compound that serves as a versatile reactant in various chemical reactions and applications. It is known for its unique properties, including its ability to form boronic acid-based inhibitors, boronated phosphonium salts, and its potential in enhancing gene transfection and optical glucose-sensing capabilities.
Uses
1. Used in Pharmaceutical Industry:
4-(Bromomethyl)phenylboronic acid is used as a reactant for the design of boronic acid-based autotaxin inhibitors. These inhibitors play a crucial role in the development of drugs targeting autotaxin, an enzyme involved in various diseases, including cancer and fibrosis.
2. Used in Chemical Synthesis:
In the field of chemical synthesis, 4-(Bromomethyl)phenylboronic acid is utilized as a key reactant in the synthesis of boronated phosphonium salts. These salts have potential applications in various chemical processes and materials science.
3. Used in Genetic Research:
4-(Bromomethyl)phenylboronic acid is used as a component in studies aimed at incorporating boronic acid groups to enhance gene transfection capability. This application is significant in the field of genetic research and gene therapy, as it can improve the efficiency of gene delivery and expression.
4. Used in Analytical Chemistry:
In analytical chemistry, 4-(Bromomethyl)phenylboronic acid is employed in investigations of the effect of boronic acid-positioning in optical glucose-sensing ensemble. This research is essential for the development of advanced glucose sensors and diagnostic tools for monitoring glucose levels in various applications, such as diabetes management.
5. Used in Suzuki Reaction:
4-(Bromomethyl)phenylboronic acid is also used as a reactant in the Suzuki reaction, a widely employed method for the formation of carbon-carbon bonds in organic synthesis. This reaction is crucial in the synthesis of various complex molecules and pharmaceutical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 68162-47-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,6 and 2 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68162-47:
(7*6)+(6*8)+(5*1)+(4*6)+(3*2)+(2*4)+(1*7)=140
140 % 10 = 0
So 68162-47-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BBrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5H2
68162-47-0Relevant articles and documents
Indole and quinoline derivatives and its preparation method and application
-
Paragraph 0243; 0246; 0247, (2017/02/28)
The invention provides an indoloquinoline derivative, a preparation method and application thereof in preparing antitumor drugs and antiviral drugs. The chemical structure of the indoloquinoline derivative is shown as a formula I. Experiments show that a partly-boric-acid-modified indoloquinoline derivative and a non-boric-acid-modified indoloquinoline derivative have strong inhibition effect on various tumor cell strains, thereby being capable of being used for preparation of the antitumor drugs, and have strong antiviral activity, thereby being capable of being used for preparation of the antiviral drugs.
Synthesis of (azidomethyl)phenylboronic acids
Fedorov,Shchepalov,Bol'shakov,Shavyrin,Kurskii,Finet,Zelentsov
, p. 370 - 375 (2007/10/03)
The synthesis of 2-, 3-, and 4-(azidomethyl)phenylboronic acids was carried out. The geometric and electronic structures were studied by quantum-chemical methods. The suggestion is made that there are weak intramolecular interactions between the boron atom and the nitrene nitrogen atom of the azido group.