67314-98-1 Usage
Description
(7aS,12aS)-3,3-Dimethyl-3H,7H-benzofuro[3,2-c]pyrano[3,2-g][1]benzopyran-7a,10(12aH)-diol is a benzofuropyranochromene compound characterized by the presence of 3H,7H-[1]benzofuro[3,2-c]pyrano[3,2-g]chromene as its core structure. It features hydroxy groups at positions 7a and 10, and a gem-dimethyl group at position 3.
Uses
Used in Pharmaceutical Industry:
(7aS,12aS)-3,3-Dimethyl-3H,7H-benzofuro[3,2-c]pyrano[3,2-g][1]benzopyran-7a,10(12aH)-diol is used as a pharmaceutical candidate for its potential therapeutic properties. Its unique chemical structure allows it to interact with various biological targets, making it a promising agent for the development of new drugs.
Used in Drug Delivery Systems:
(7aS,12aS)-3,3-Dimethyl-3H,7H-benzofuro[3,2-c]pyrano[3,2-g][1]benzopyran-7a,10(12aH)-diol can be employed in drug delivery systems to improve the bioavailability and therapeutic efficacy of other drugs. Its chemical properties may enable the development of novel carriers and formulations that enhance drug delivery and targeting.
Used in Chemical Research:
(7aS,12aS)-3,3-Dimethyl-3H,7H-benzofuro[3,2-c]pyrano[3,2-g][1]benzopyran-7a,10(12aH)-diol serves as a valuable compound for chemical research, particularly in the field of organic chemistry and medicinal chemistry. Its unique structure and properties make it an interesting subject for studying chemical reactions, synthesis, and potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 67314-98-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,3,1 and 4 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 67314-98:
(7*6)+(6*7)+(5*3)+(4*1)+(3*4)+(2*9)+(1*8)=141
141 % 10 = 1
So 67314-98-1 is a valid CAS Registry Number.
InChI:InChI=1/C20H18O5/c1-19(2)6-5-11-7-13-16(9-15(11)25-19)23-10-20(22)14-4-3-12(21)8-17(14)24-18(13)20/h3-9,18,21-22H,10H2,1-2H3/t18-,20+/m0/s1