6627-60-7 Usage
Description
6-Methyl-2-pyridinemethanamine, also known as (6-Methylpyridin-2-yl)methanamine, is a pyridine derivative characterized by the presence of a methyl group at the 6th position and an amine group attached to the 2nd position of the pyridine ring. This organic compound exhibits unique chemical properties and reactivity due to its structural features, making it a versatile building block in various chemical and pharmaceutical applications.
Uses
Used in Chemical Synthesis:
6-Methyl-2-pyridinemethanamine is used as a synthetic intermediate for the preparation of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its reactivity and functional groups allow for the formation of diverse chemical entities through reactions such as amination, acylation, and alkylation.
Used in Complexing Agents:
6-Methyl-2-pyridinemethanamine is employed as a complexing agent in various applications, including the synthesis of metal-organic frameworks (MOFs) and coordination compounds. Its ability to form stable complexes with metal ions makes it a valuable component in the development of new materials with potential applications in catalysis, gas storage, and drug delivery.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-Methyl-2-pyridinemethanamine is used as a key building block for the development of novel drug candidates. Its unique structure and functional groups enable the design of molecules with specific biological activities, targeting a wide range of therapeutic areas such as central nervous system disorders, cardiovascular diseases, and oncology.
Used in Agrochemical Industry:
6-Methyl-2-pyridinemethanamine is utilized as a starting material for the synthesis of agrochemicals, including pesticides and herbicides. Its chemical properties allow for the development of effective compounds that can protect crops from pests and diseases, thereby contributing to increased agricultural productivity.
Used in Material Science:
In the field of material science, 6-Methyl-2-pyridinemethanamine is used as a component in the development of advanced materials with specific properties, such as conductivity, magnetism, and optical activity. Its ability to form complexes with various metal ions and organic molecules makes it a promising candidate for the creation of new materials with potential applications in sensors, energy storage, and electronic devices.
Check Digit Verification of cas no
The CAS Registry Mumber 6627-60-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,2 and 7 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6627-60:
(6*6)+(5*6)+(4*2)+(3*7)+(2*6)+(1*0)=107
107 % 10 = 7
So 6627-60-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2/c1-6-3-2-4-7(5-8)9-6/h2-4H,5,8H2,1H3
6627-60-7Relevant articles and documents
Selective synthesis of mono- and di-methylated amines using methanol and sodium azide as C1 and N1 sources
Chakrabarti, Kaushik,Mishra, Anju,Panja, Dibyajyoti,Paul, Bhaskar,Kundu, Sabuj
supporting information, p. 3339 - 3345 (2018/07/29)
A Ru(ii) complex mediated synthesis of various N,N-dimethyl and N-monomethyl amines from organic azides using methanol as a methylating agent is reported. This methodology was successfully applied for a one-pot reaction of bromide derivatives and sodium azide in methanol. Notably, by controlling the reaction time several N-monomethylated and N,N-dimethylated amines were synthesized selectively. The practical applicability of this tandem process was revealed by preparative scale reactions with different organic azides and synthesis of an anti-vertigo drug betahistine. Several kinetic experiments and DFT studies were carried out to understand the mechanism of this transformation.
