66256-62-0 Usage
Description
4-methyl-2-propylhexan-1-ol, commonly known as Isoamyl alcohol, is a clear, colorless liquid characterized by a strong, pungent odor. It is a primary alcohol with the molecular formula C6H14O and a molecular weight of 102.17 g/mol. 4-methyl-2-propylhexan-1-ol is recognized for its versatile applications across various industries due to its unique chemical properties.
Uses
Used in the Chemical Industry:
Isoamyl alcohol is utilized as a solvent in numerous industrial processes, leveraging its ability to dissolve a wide range of substances, which is crucial for various chemical reactions and processes.
Used in the Flavor and Fragrance Industry:
It serves as a raw material for the production of flavors and fragrances, capitalizing on its properties to enhance or create specific scents and tastes in consumer products.
Used in the Beverage Industry:
Isoamyl alcohol is employed as a fermentation alcohol in the production of certain alcoholic beverages, contributing to their unique taste profiles and characteristics.
Used in the Pharmaceutical Industry:
It acts as a chemical intermediate in the synthesis of pharmaceuticals and other organic compounds, playing a pivotal role in the development of new medications and therapies.
Safety Considerations:
Given its flammable nature and toxic and irritant properties when inhaled or ingested, Isoamyl alcohol requires careful handling and proper safety measures to prevent accidents and health hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 66256-62-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,2,5 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 66256-62:
(7*6)+(6*6)+(5*2)+(4*5)+(3*6)+(2*6)+(1*2)=140
140 % 10 = 0
So 66256-62-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H22O/c1-4-6-10(8-11)7-9(3)5-2/h9-11H,4-8H2,1-3H3
