6298-11-9 Usage
Description
4-PYRIDINEETHANETHIOL HYDROCHLORIDE, also known as 4-Pyridylethylmercaptan Hydrochloride (CAS# 6298-11-9), is a white-yellow crystalline solid compound that is useful in organic synthesis. It is characterized by its unique chemical structure, which contributes to its various applications in different industries.
Uses
Used in Organic Synthesis:
4-PYRIDINEETHANETHIOL HYDROCHLORIDE is used as a synthetic building block for the development of various organic compounds. Its chemical properties make it a versatile and valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-PYRIDINEETHANETHIOL HYDROCHLORIDE is used as a key intermediate in the synthesis of drugs targeting various therapeutic areas. Its unique chemical structure allows for the development of novel drug candidates with potential applications in treating diseases such as cancer, neurological disorders, and infectious diseases.
Used in Agrochemical Industry:
4-PYRIDINEETHANETHIOL HYDROCHLORIDE is also utilized in the agrochemical industry for the synthesis of active ingredients in pesticides and other crop protection products. Its chemical properties enable the development of innovative compounds with improved efficacy and selectivity, contributing to more sustainable and effective agricultural practices.
Used in Chemical Research:
In the field of chemical research, 4-PYRIDINEETHANETHIOL HYDROCHLORIDE serves as a valuable compound for studying various chemical reactions and mechanisms. Its unique structure allows researchers to explore new reaction pathways and develop innovative synthetic strategies, further expanding the scope of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 6298-11-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,9 and 8 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6298-11:
(6*6)+(5*2)+(4*9)+(3*8)+(2*1)+(1*1)=109
109 % 10 = 9
So 6298-11-9 is a valid CAS Registry Number.
InChI:InChI=1/C25H17ClF2N2O2/c26-22-4-2-1-3-19(22)16-30-14-13-29-24(30)15-23(17-5-9-20(27)10-6-17)32-25(31)18-7-11-21(28)12-8-18/h1-15H,16H2/b23-15+