6289-52-7 Usage
Description
3-(dibutylamino)propane-1,2-diol, also known as DBAPD, is a chemical compound characterized by its molecular formula C13H29NO2. It features a tertiary amine structure with two hydroxyl groups attached to a propane backbone. This versatile compound is recognized for its applications across various industries due to its unique chemical properties.
Uses
Used in Epoxy Resin Production:
DBAPD is utilized as a curing agent in the manufacturing process of epoxy resins. Its role is crucial in enhancing the flexibility and toughness of the final product, which is essential for the performance of epoxy resins in various applications.
Used in Polyurethane Foam Formulation:
In the polyurethane industry, DBAPD serves as a stabilizer, contributing to the formation of polyurethane foams with desired properties. Its presence helps in controlling the reaction kinetics and ensuring the stability of the foam during production.
Used in Metalworking Fluids:
DBAPD is employed as a corrosion inhibitor in metalworking fluids, protecting metal surfaces from corrosion during machining processes. This extends the life of the machinery and the tools used, while also ensuring the quality of the finished metal products.
Check Digit Verification of cas no
The CAS Registry Mumber 6289-52-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6289-52:
(6*6)+(5*2)+(4*8)+(3*9)+(2*5)+(1*2)=117
117 % 10 = 7
So 6289-52-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H25NO2/c1-3-5-7-12(8-6-4-2)9-11(14)10-13/h11,13-14H,3-10H2,1-2H3