610-93-5 Usage
Description
6-Nitrophthalide is a fluorescent heterocycle that exhibits inhibitory properties against various catalytic asymmetric processes. It is homologous to other fluorescent probes such as fluorescein, nitrobenzene, and nitrophenol. Its unique structure and properties make it a promising candidate for use in various applications.
Uses
Used in Chemical Research:
6-Nitrophthalide is used as a fluorescent probe for specific inhibition in chemical research. Its inhibitory properties against triazole and dipole make it a valuable tool for studying and controlling various catalytic asymmetric reactions.
Used in Organic Chemistry:
6-Nitrophthalide is used as an inhibitor in organic chemistry for the oxidation of aldehydes. Its ability to inhibit this process allows for greater control over chemical reactions and the synthesis of complex organic molecules.
Used in Analytical Chemistry:
6-Nitrophthalide's fluorescent properties make it useful as a probe in analytical chemistry. Its ability to bind to specific molecules and inhibit their activity allows for the detection and analysis of various compounds in complex mixtures.
Used in Drug Development:
6-Nitrophthalide's inhibitory properties can be harnessed in drug development for the design of new therapeutic agents. Its ability to target specific enzymes and pathways involved in disease processes could lead to the development of more effective treatments for various conditions.
Used in Environmental Monitoring:
6-Nitrophthalide's fluorescent properties can be utilized in environmental monitoring to detect and analyze pollutants and contaminants. Its ability to bind to specific molecules and inhibit their activity can help in the identification and quantification of harmful substances in the environment.
Preparation
6-Nitrophthalide is synthesized from 2-nitrobenzaldehyde via a two-step process, and then reacted with methyl iodide.
Check Digit Verification of cas no
The CAS Registry Mumber 610-93-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,1 and 0 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 610-93:
(5*6)+(4*1)+(3*0)+(2*9)+(1*3)=55
55 % 10 = 5
So 610-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H5NO4/c10-8-7-3-6(9(11)12)2-1-5(7)4-13-8/h1-3H,4H2
