59812-12-3 Usage
Description
N-(ETHOXYCARBONYL)THIOPROPIONAMIDE, also known as a thioester amide, is an organic compound with the chemical formula C6H11NO2S. It is a yellow oil at room temperature and is known for its potential applications in the pharmaceutical industry. Its unique chemical structure allows it to form various derivatives, making it a versatile compound for research and development.
Uses
Used in Pharmaceutical Industry:
N-(ETHOXYCARBONYL)THIOPROPIONAMIDE is used as a key intermediate compound for the synthesis of urea and carbamate derivatives. These derivatives have potential applications as non-nucleoside HIV-1 reverse transcriptase inhibitors, which are crucial in the development of antiretroviral drugs for the treatment of HIV/AIDS. N-(ETHOXYCARBONYL)THIOPROPIONAMIDE's ability to form these derivatives makes it a valuable asset in the fight against the virus.
Check Digit Verification of cas no
The CAS Registry Mumber 59812-12-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,8,1 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59812-12:
(7*5)+(6*9)+(5*8)+(4*1)+(3*2)+(2*1)+(1*2)=143
143 % 10 = 3
So 59812-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2S/c1-3-5(10)7-6(8)9-4-2/h3-4H2,1-2H3,(H,7,8,10)