59639-91-7 Usage
Description
Potassium 2-chloro-4-nitrobenzoate, also known as 2-chloro-4-nitrobenzoic acid potassium salt, is a chemical compound that contains potassium and is derived from 2-chloro-4-nitrobenzoic acid. It is characterized by its versatile properties in chemical reactions and is commonly used in organic synthesis, pharmacology, and as a building block in the production of various pharmaceuticals.
Uses
Used in Organic Synthesis:
Potassium 2-chloro-4-nitrobenzoate is used as a reagent in the preparation of various derivatives, contributing to the synthesis of complex organic molecules due to its versatile properties in chemical reactions.
Used in Pharmaceutical Production:
In the pharmaceutical industry, potassium 2-chloro-4-nitrobenzoate serves as a building block for the production of various pharmaceuticals, playing a crucial role in the development of new drugs and medicines.
Used in Dye and Pigment Manufacturing:
Potassium 2-chloro-4-nitrobenzoate is utilized in the manufacturing of certain dyes and pigments, capitalizing on its ability to form colored complexes, which are essential for creating a wide range of colors in various applications.
Used in Research and Development:
As a research tool, potassium 2-chloro-4-nitrobenzoate is employed in the study of organic chemistry and pharmaceutical development, aiding scientists in understanding chemical reactions and exploring new avenues for drug discovery and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 59639-91-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,6,3 and 9 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 59639-91:
(7*5)+(6*9)+(5*6)+(4*3)+(3*9)+(2*9)+(1*1)=177
177 % 10 = 7
So 59639-91-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClNO4.K/c8-6-3-4(9(12)13)1-2-5(6)7(10)11;/h1-3H,(H,10,11);/q;+1/p-1
