58986-28-0 Usage
Description
Sodium ethyl 3-oxidoacrylate is a chemical compound that consists of sodium, ethyl, and 3-oxidoacrylate groups. It is a derivative of acrylate, which is widely used in various industrial applications. sodium ethyl 3-oxidoacrylate is known for its unique properties and characteristics due to the combination of its constituent groups, making it a valuable component in the chemical industry.
Uses
Used in Polymer Production:
Sodium ethyl 3-oxidoacrylate is used as a monomer in the production of polymers. Its unique chemical structure allows for the creation of polymers with specific properties, making it suitable for various applications.
Used in Adhesives:
In the adhesives industry, sodium ethyl 3-oxidoacrylate is used as a component to enhance the bonding properties of adhesives. Its chemical structure contributes to the development of adhesives with improved strength and durability.
Used in Coatings:
Sodium ethyl 3-oxidoacrylate is utilized in the formulation of coatings to provide specific characteristics such as durability, resistance to environmental factors, and adhesion to various surfaces. Its unique properties make it a valuable component in the coatings industry.
Used in Organic Synthesis:
As a building block in organic synthesis, sodium ethyl 3-oxidoacrylate is used as a key component in the creation of more complex chemicals. Its combination of sodium and ethyl groups allows for the development of a wide range of chemical compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 58986-28-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,9,8 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 58986-28:
(7*5)+(6*8)+(5*9)+(4*8)+(3*6)+(2*2)+(1*8)=190
190 % 10 = 0
So 58986-28-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H8O3/c1-2-8-5(7)3-4-6/h3-4,6H,2H2,1H3/b4-3+
