57196-63-1 Usage
Description
2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is a chemical compound with the molecular formula C12H17ClO. It is a chlorinated ketone with a bulky pentamethylphenyl group attached to the carbon atom. This unique structure and reactivity make it a valuable building block for creating complex molecules in chemical synthesis.
Uses
Used in Pharmaceutical Industry:
2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of complex molecular structures.
Used in Agrochemical Industry:
2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is used as an intermediate in the synthesis of agrochemicals, playing a role in the creation of molecules that can be utilized in agricultural applications.
Used in Dyes Industry:
2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is used as an intermediate in the synthesis of dyes, contributing to the development of new colorants for various industries.
Used in Medicinal Chemistry:
2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is used as a building block in medicinal chemistry for its potential to create molecules with therapeutic properties.
Used in Materials Science:
2-CHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHAN-1-ONE is used in materials science for its potential to contribute to the development of new materials with unique properties.
Check Digit Verification of cas no
The CAS Registry Mumber 57196-63-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,1,9 and 6 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 57196-63:
(7*5)+(6*7)+(5*1)+(4*9)+(3*6)+(2*6)+(1*3)=151
151 % 10 = 1
So 57196-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H17ClO/c1-7-8(2)10(4)13(12(15)6-14)11(5)9(7)3/h6H2,1-5H3
