56071-69-3 Usage
Derivative of phenyl and bromo-substituted propanone
The compound is derived from phenyl (a benzene ring with a hydrogen atom) and bromo-substituted propanone (a propanone molecule with a bromine atom replacing one hydrogen atom).
Acetyloxy group attached to the phenyl ring
The phenyl ring in the compound has an acetyloxy group (an ester derived from acetic acid) attached to it, which contributes to its unique chemical properties.
Used in organic synthesis and pharmaceutical research
The compound serves as a building block for more complex molecules in the fields of organic chemistry and pharmaceutical research.
Building block for more complex molecules
Due to its unique structure, the compound can be used to create a variety of complex molecules with potential applications in various industries.
Used in the production of various drugs and biologically active compounds
The compound's reactivity and unique structure make it a valuable component in the synthesis of drugs and other biologically active substances.
Potential applications in the development of new pharmaceuticals and agrochemicals
The compound's unique chemical structure and reactivity make it a promising candidate for the development of new drugs and agrochemicals, which could have significant impacts on various industries.
Unique chemical structure and reactivity
The compound's structure, which includes a bromine atom, an acetyloxy group, and a phenyl ring, contributes to its unique reactivity and potential for use in the development of new compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 56071-69-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,0,7 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 56071-69:
(7*5)+(6*6)+(5*0)+(4*7)+(3*1)+(2*6)+(1*9)=123
123 % 10 = 3
So 56071-69-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H11BrO3/c1-8(13)15-11-4-2-9(3-5-11)6-10(14)7-12/h2-5H,6-7H2,1H3
56071-69-3Relevant articles and documents
Regio- And chemoselective multiple functionalization of chloropyrazine derivatives. Application to the synthesis of coelenterazine
Mosrin, Marc,Bresser, Tomke,Knochel, Paul
supporting information; experimental part, p. 3406 - 3409 (2009/12/01)
Successive regio- and chemoselective metalations of chloropyrazines using TMPMgCl-LiCl and TMPZnCIIiCI furnish, after trapping with electrophiles, highly functionalized pyrazines in high yields. Application to a synthesis of coelenterazine, a bioluminescent natural product in jellyfish Aequorea victoria, in nine steps (9% overall yield) is reported.
