54832-24-5 Usage
Uses
Used in Pharmaceutical Industry:
5-(4-Hydroxyphenyl)hydantoin is used as an anticonvulsant agent for the treatment of seizures. Its pharmacological properties make it a valuable compound in the development of medications to manage epilepsy and other seizure disorders.
Used in Research and Development:
5-(4-Hydroxyphenyl)hydantoin is used as a research compound for studying its chemical properties and potential applications in various fields, such as drug development and material science. Its unique structure and pharmacological effects provide a basis for further investigation into its possible uses and benefits.
Used in Drug Synthesis:
5-(4-Hydroxyphenyl)hydantoin is used as an intermediate in the synthesis of other pharmaceutical compounds. Its chemical structure can be modified to create new drugs with potential therapeutic applications, contributing to the advancement of medicine and healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 54832-24-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,8,3 and 2 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 54832-24:
(7*5)+(6*4)+(5*8)+(4*3)+(3*2)+(2*2)+(1*4)=125
125 % 10 = 5
So 54832-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O3/c12-6-3-1-5(2-4-6)7-8(13)11-9(14)10-7/h1-4,7,12H,(H2,10,11,13,14)
