54013-06-8 Usage
General Description
Ethyl 5-amino-2-pyrazinecarboxylate is a chemical compound that often features in scientific and industrial research. Primarily used as a pharmaceutical intermediate, it provides a crucial impact in the preparation of complex biological active molecules and pharmaceuticals. This organic compound is a derivative of pyrazine, and it possesses the molecular formula C7H9N3O2. Additionally, it falls under the category of esters and carboxylic acids, indicating it possesses generic properties of these compound classes, including various potential reactions depending on its usage and treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 54013-06-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,0,1 and 3 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54013-06:
(7*5)+(6*4)+(5*0)+(4*1)+(3*3)+(2*0)+(1*6)=78
78 % 10 = 8
So 54013-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9N3O2/c1-2-12-7(11)5-3-10-6(8)4-9-5/h3-4H,2H2,1H3,(H2,8,10)
