5398-25-4 Usage
Description
2,3-Dibromopentane, with the molecular formula C5H10Br2, is a chemical compound that exists as a clear, colorless liquid at room temperature. It is highly flammable and features bromine atoms that confer high reactivity, allowing it to participate in various chemical reactions such as nucleophilic substitution and elimination reactions.
Uses
Used in Pharmaceutical and Agrochemical Industries:
2,3-Dibromopentane is utilized as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and agricultural products.
Used as a Solvent in Chemical Reactions:
Due to its reactivity, 2,3-dibromopentane serves as a solvent in certain chemical reactions, facilitating the process and aiding in achieving desired outcomes.
Used as a Precursor to Other Organic Compounds:
2,3-DIBROMOPENTANE also acts as a precursor to other organic compounds, enabling the creation of a range of products through further chemical modifications.
It is crucial to handle 2,3-dibromopentane with care due to its flammability and potential health risks associated with exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 5398-25-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,9 and 8 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5398-25:
(6*5)+(5*3)+(4*9)+(3*8)+(2*2)+(1*5)=114
114 % 10 = 4
So 5398-25-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H10Br2/c1-3-5(7)4(2)6/h4-5H,3H2,1-2H3