53660-23-4 Usage
Description
2-PROPYL-5-HYDROXYPENTANOIC ACID, a metabolite of Valproic Acid, is an organic compound with chemical properties characterized by its pale yellow thick syrup appearance. 2-PROPYL-5-HYDROXYPENTANOIC ACID also contains an undetermined amount of water and the analogous lactone.
Uses
Used in Pharmaceutical Industry:
2-PROPYL-5-HYDROXYPENTANOIC ACID is used as an intermediate compound for the synthesis of various pharmaceutical products. Its presence as a metabolite of Valproic Acid, a widely used medication for epilepsy and bipolar disorder, makes it a valuable component in the development of new drugs and therapies.
Used in Chemical Research:
2-PROPYL-5-HYDROXYPENTANOIC ACID serves as a key compound in chemical research, particularly in the study of organic synthesis, drug metabolism, and the development of novel therapeutic agents. Its unique chemical properties and structure allow researchers to explore its potential applications and interactions with other molecules.
Used in Drug Delivery Systems:
Similar to gallotannin, 2-PROPYL-5-HYDROXYPENTANOIC ACID can be employed in the development of drug delivery systems to enhance the bioavailability and therapeutic outcomes of various medications. Its chemical properties and compatibility with different carriers make it a promising candidate for improving drug delivery and targeting specific diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 53660-23-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,6,6 and 0 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 53660-23:
(7*5)+(6*3)+(5*6)+(4*6)+(3*0)+(2*2)+(1*3)=114
114 % 10 = 4
So 53660-23-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H16O3/c1-2-4-7(8(10)11)5-3-6-9/h7,9H,2-6H2,1H3,(H,10,11)
