53242-18-5 Usage
Description
5-AMINO-3-BROMO-2-METHOXYPYRIDINE is a heterocyclic chemical compound with the molecular formula C6H6BrN2O. It features a pyridine ring structure with a bromine atom and a methoxy group attached, making it a valuable building block in the synthesis of pharmaceuticals and agrochemicals. This versatile compound has also been studied for its potential use in organic synthesis and medicinal chemistry, as well as for its antimicrobial properties, which contribute to the development of new antimicrobial agents.
Uses
Used in Pharmaceutical Industry:
5-AMINO-3-BROMO-2-METHOXYPYRIDINE is used as a building block for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure and properties make it a promising candidate for the creation of novel compounds with potential medicinal applications.
Used in Agrochemical Industry:
In the agrochemical industry, 5-AMINO-3-BROMO-2-METHOXYPYRIDINE serves as a key component in the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products can enhance their effectiveness and contribute to more sustainable agricultural practices.
Used in Organic Synthesis:
5-AMINO-3-BROMO-2-METHOXYPYRIDINE is utilized as a versatile intermediate in organic synthesis, allowing for the creation of a wide range of organic compounds. Its unique structure and reactivity make it a valuable tool for chemists in the development of new organic compounds with various applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-AMINO-3-BROMO-2-METHOXYPYRIDINE is employed as a potential candidate for the development of new drugs and therapeutic agents. Its unique properties and structure make it a promising starting point for the design and synthesis of novel compounds with potential medicinal applications.
Used in Antimicrobial Agents Development:
5-AMINO-3-BROMO-2-METHOXYPYRIDINE is used as a key component in the development of new antimicrobial agents due to its inherent antimicrobial properties. Its incorporation into antimicrobial formulations can enhance their effectiveness against various pathogens, contributing to the fight against antibiotic resistance and the development of new treatments for infectious diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 53242-18-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,2,4 and 2 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 53242-18:
(7*5)+(6*3)+(5*2)+(4*4)+(3*2)+(2*1)+(1*8)=95
95 % 10 = 5
So 53242-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrN2O/c1-10-6-5(7)2-4(8)3-9-6/h2-3H,8H2,1H3
