52980-52-6 Usage
Description
(5-NITRO-2-FUROYL)AMINO]ACETIC ACID, also known as NFAA, is a chemical compound with the molecular formula C7H6N2O6. It is a nitrofuran derivative, which is a class of compounds commonly used in the pharmaceutical industry for their antimicrobial and antiparasitic properties. NFAA has been studied for its potential use as an antibacterial agent and has shown promising results in inhibiting the growth of certain pathogenic bacteria. Additionally, it has also been investigated for its potential use in cancer treatment due to its ability to target and inhibit specific cancer cell lines. NFAA may have a range of potential applications in medicine and biotechnology due to its diverse chemical properties and biological effects.
Used in Pharmaceutical Industry:
NFAA is used as an antimicrobial and antiparasitic agent for its ability to inhibit the growth of certain pathogenic bacteria and target specific cancer cell lines.
Used in Antibacterial Applications:
NFAA is used as an antibacterial agent for its potential to inhibit the growth of certain pathogenic bacteria, making it a promising candidate for the development of new antibiotics.
Used in Cancer Treatment:
NFAA is used as a potential cancer treatment agent for its ability to target and inhibit specific cancer cell lines, offering a new approach to cancer therapy.
Used in Medicine and Biotechnology:
NFAA is used in medicine and biotechnology for its diverse chemical properties and biological effects, which may lead to the development of new drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 52980-52-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,9,8 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 52980-52:
(7*5)+(6*2)+(5*9)+(4*8)+(3*0)+(2*5)+(1*2)=136
136 % 10 = 6
So 52980-52-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N2O6/c10-6(11)3-8-7(12)4-1-2-5(15-4)9(13)14/h1-2H,3H2,(H,8,12)(H,10,11)/p-1
