517-71-5 Usage
Description
Xylopine, an alkaloid derived from Xylopia discreta, belongs to the noraporphine class of bases. It is characterized by its crystalline structure, which forms colorless needles when crystallized from Me2CO. Xylopine exhibits a specific optical rotation of [α]25/sup>D 23.4°C (MeOH). The crystalline hydrochloride form of Xylopine has a melting point of 250°C, while its N-acetyl derivative has a melting point of 213-4°C. Its molecular structure features one methoxyl group and one methylenedioxy group, with the overall structure resembling that of O-methylanolobine.
Uses
1. Used in Pharmaceutical Industry:
Xylopine is used as a pharmaceutical compound for its potential therapeutic applications. The expression is: Xylopine is used as a pharmaceutical compound for its potential therapeutic applications.
2. Used in Chemical Research:
Xylopine serves as a valuable compound in chemical research, particularly in the study of alkaloids and their derivatives. The expression is: Xylopine is used as a research compound for the study of alkaloids and their derivatives.
3. Used in Drug Development:
Due to its unique structure and properties, Xylopine may be utilized in the development of new drugs targeting various medical conditions. The expression is: Xylopine is used as a starting material for drug development targeting various medical conditions.
4. Used in Natural Product Chemistry:
Xylopine, being a naturally occurring alkaloid, can be employed in the field of natural product chemistry to explore its potential interactions with other compounds and its overall role in the plant's defense mechanisms. The expression is: Xylopine is used as a natural product for studying its interactions with other compounds and its role in plant defense mechanisms.
5. Used in Toxicological Studies:
Given its alkaloid nature, Xylopine may be investigated for its potential toxicological effects, which could be relevant in understanding its safety profile and applicability in various industries. The expression is: Xylopine is used as a subject for toxicological studies to assess its safety profile and applicability in various industries.
References
Schmutz., Helv. Chim. Acta, 42, 335 (1959)
Check Digit Verification of cas no
The CAS Registry Mumber 517-71-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,1 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 517-71:
(5*5)+(4*1)+(3*7)+(2*7)+(1*1)=65
65 % 10 = 5
So 517-71-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H17NO3/c1-20-12-2-3-13-11(6-12)7-14-16-10(4-5-19-14)8-15-18(17(13)16)22-9-21-15/h2-3,6,8,14,19H,4-5,7,9H2,1H3/t14-/m1/s1
517-71-5Relevant articles and documents
ALKALOIDS OF FORMOSAN FISSISTIGMA AND GONIOTHALAMUS SPECIES
Lu, Sheng-Teh,Wu, Yang-Chang,Leou, Shiow-Piaw
, p. 1829 - 1834 (2007/10/02)
Separation of the basic fractions from Formosan Fissistigma glaucescens, F. oldhamii and Goniothalamus amuyron afforded one new quaternary phenanthrene alkaloid, N-methylatherosperminium (15), along with the known alkaloids, (-)-discretamine (1), (-)-tetrahydropalmatine (2), palmatine (3), (-)-asimilobine (4), (-)-norannuradhapurine (5), (-)-crebanine (6), (-)-calycinine (fissoldine, fissistigine A) (7a), (-)-anolobine (8), (-)-xylopine (9), (-)-anonaine (10a), oxocrebanine (11), liriodenine (12), atherosperminine (13), N-noratherosperminine (14) and (+)-O-methylflavinantine (O-methylpallidine) (16) Key Word Index - Fissistigma glaucescens; F. oldhamii; Goniothalamus amuyron; Annonaceae; alkaloids; quaternary phenanthrene alkaloid; N-methylatherosperminium.