436-30-6 Usage
Chemical class
Acridine derivatives
Structural features
Presence of a fluorine atom at the 10th position and a methyl group at the 12th position of the benz[a]acridine structure
Potential applications
Medicinal chemistry and drug development
Anti-cancer properties
Exhibits cytotoxic activity against cancer cells, making it a promising candidate for further investigation as a potential anti-cancer agent
Anti-microbial properties
Has been studied for its potential anti-microbial properties
Chemical synthesis
Its structural features and reactivity make it an interesting target for chemical synthesis
Structure-activity relationship studies
Useful for understanding the relationship between its chemical structure and biological activities
Further research needed
To fully elucidate its biological activities and potential applications in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 436-30-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,3 and 6 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 436-30:
(5*4)+(4*3)+(3*6)+(2*3)+(1*0)=56
56 % 10 = 6
So 436-30-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H12FN/c1-11-15-10-13(19)7-9-16(15)20-17-8-6-12-4-2-3-5-14(12)18(11)17/h2-10H,1H3