385370-80-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-6-methoxyphenylboronic acid is used as a reactant in the palladium-catalyzed Suzuki-Miyaura coupling reaction for the synthesis of canthin-6-one alkaloids. This reaction involves reacting it with 8-bromo-1,5-naphthyridin-2-one via Pd-catalyzed Suzuki coupling and Cu-catalyzed amidation reactions, which are crucial for the development of potential therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 2-Chloro-6-methoxyphenylboronic acid is used as a reactant for the preparation of tryptamines. This is achieved through the Suzuki coupling of vinylsulfonylmethyl resin-bound bromotryptamine, which is an important class of compounds with diverse biological activities and potential applications in medicine.
Used in Chemical Research:
2-Chloro-6-methoxyphenylboronic acid is also utilized in chemical research as a building block for the synthesis of various organic compounds. Its reactivity in palladium-catalyzed cross-coupling reactions allows for the formation of new carbon-carbon bonds, which is essential for creating complex molecular structures with potential applications in materials science, pharmaceuticals, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 385370-80-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,5,3,7 and 0 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 385370-80:
(8*3)+(7*8)+(6*5)+(5*3)+(4*7)+(3*0)+(2*8)+(1*0)=169
169 % 10 = 9
So 385370-80-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H8BClO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,10-11H,1H3
