35202-25-6 Usage
Description
5-(4-Chlorophenyl)pyrimidin-4-amine is a pyrimidine derivative with the molecular formula C11H8ClN3. It features a 4-aminopyrimidine structure and a 4-chlorophenyl group attached to the 5-position. This chemical compound is known for its unique structure and properties, which make it a promising candidate for pharmaceutical and chemical research. The 4-chlorophenyl group enhances the compound's chemical reactivity and potential interactions with biological targets, making it a valuable building block for the synthesis of novel compounds with desired properties. Overall, 5-(4-Chlorophenyl)pyrimidin-4-amine is a versatile and important chemical with potential applications in various scientific and industrial fields.
Uses
Used in Pharmaceutical Research and Development:
5-(4-Chlorophenyl)pyrimidin-4-amine is used as a key intermediate in the synthesis of new drugs. Its unique structure and properties allow it to be a valuable building block for the development of pharmaceutical compounds with specific therapeutic effects.
Used in Agrochemical Research and Development:
In the agrochemical industry, 5-(4-Chlorophenyl)pyrimidin-4-amine is used as a starting material for the synthesis of novel agrochemicals. Its potential interactions with biological targets make it a promising candidate for the development of new pesticides, herbicides, and other agrochemical products.
Used in Material Science:
5-(4-Chlorophenyl)pyrimidin-4-amine is used as a component in the development of new materials with specific properties. Its unique structure and chemical reactivity contribute to the creation of materials with potential applications in various industries, such as electronics, coatings, and polymers.
Used in Chemical Research:
As a pyrimidine derivative with a 4-chlorophenyl group, 5-(4-Chlorophenyl)pyrimidin-4-amine is used in chemical research to explore its reactivity, synthesis pathways, and potential applications in the synthesis of other novel compounds. This research can lead to the discovery of new chemical reactions and the development of innovative synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 35202-25-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,2,0 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 35202-25:
(7*3)+(6*5)+(5*2)+(4*0)+(3*2)+(2*2)+(1*5)=76
76 % 10 = 6
So 35202-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClN3/c11-8-3-1-7(2-4-8)9-5-13-6-14-10(9)12/h1-6H,(H2,12,13,14)
