29682-46-0 Usage
Description
2,6-DICHLORO-3-NITROTOLUENE is an organic compound characterized by its light yellow to light green solid appearance. It is a significant intermediate in various chemical syntheses and holds potential applications across different industries due to its unique chemical properties.
Uses
Used in Organic Synthesis:
2,6-DICHLORO-3-NITROTOLUENE is used as a crucial intermediate for organic synthesis, facilitating the creation of a wide range of chemical products. Its role in this application is attributed to its reactivity and ability to form various derivatives, making it a valuable component in the synthesis process.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 2,6-DICHLORO-3-NITROTOLUENE serves as an essential raw material for the development of different medicinal compounds. Its utility stems from its potential to be incorporated into the molecular structures of various drugs, contributing to their therapeutic effects.
Used in Agrochemicals:
2,6-DICHLORO-3-NITROTOLUENE is also utilized in the agrochemical industry as a key intermediate for the production of various agrochemical products. Its application in this field is due to its ability to enhance the effectiveness of pesticides and other agricultural chemicals, thereby improving crop protection and yield.
Used in Dye Industry:
Lastly, 2,6-DICHLORO-3-NITROTOLUENE finds application in the dyestuff industry, where it is employed as a vital raw material for the synthesis of diverse dyes and pigments. Its significance in this industry lies in its potential to contribute to the color properties and stability of the resulting dyes, making it an indispensable component in the dye manufacturing process.
Check Digit Verification of cas no
The CAS Registry Mumber 29682-46-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,9,6,8 and 2 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 29682-46:
(7*2)+(6*9)+(5*6)+(4*8)+(3*2)+(2*4)+(1*6)=150
150 % 10 = 0
So 29682-46-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5Cl2NO2/c1-4-5(8)2-3-6(7(4)9)10(11)12/h2-3H,1H3
29682-46-0Relevant articles and documents
Preparation method of dichlorotoluene nitride intermediate
-
Sheet 0047-0049; 0054; 0065, (2021/01/28)
The invention belongs to the technical field of preparation of pesticide intermediates, and particularly discloses a preparation method of a dichlorotoluene nitride intermediate. The preparation method comprises the following steps: fully reacting raw materials, a solvent and a nitration reagent to obtain a dichlorotoluene nitride intermediate, wherein the raw materials comprise any one of o-dichlorotoluene, m-dichlorotoluene and p-dichlorotoluene; the solvent is dichloroethane; the nitration reagent is concentrated nitric acid; the dichlorotoluene nitride intermediate is shown as a chemical formula 7 and a chemical formula 12. The preparation method has the advantages that the corrosion to reaction equipment is less, and the generation and discharge of waste acid and waste salt in the production process are greatly reduced.
