269398-87-0 Usage
Uses
Used in Pharmaceutical Industry:
FMOC-(R)-3-AMINO-5-PHENYLPENTANOIC ACID is used as a synthetic building block for the development of peptidomimetics that target specific somatostatin receptor subtypes, such as subtypes 1 and/or 4. These peptidomimetics have potential applications in the treatment of various diseases and conditions, including neurological disorders, cancer, and gastrointestinal disorders, due to their ability to selectively modulate the activity of these receptor subtypes.
Used in Research and Development:
FMOC-(R)-3-AMINO-5-PHENYLPENTANOIC ACID is also used as a valuable tool in the research and development of novel peptide-based therapeutics and diagnostic agents. Its unique structural features and reactivity make it an attractive candidate for the design and synthesis of new peptidomimetics with tailored properties and functions, which can be further explored for their potential applications in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-87-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 269398-87:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*8)+(1*7)=210
210 % 10 = 0
So 269398-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C26H25NO4/c28-25(29)16-19(15-14-18-8-2-1-3-9-18)27-26(30)31-17-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h1-13,19,24H,14-17H2,(H,27,30)(H,28,29)/t19-/m1/s1