26447-28-9 Usage
Description
2-Furancarboxylic acid, with the molecular formula C5H4O3, is a key organic compound that features a furan ring with a carboxylic acid group. It is recognized for its diverse properties and is widely used as a precursor in the synthesis of pharmaceuticals, agrochemicals, and organic materials. 2-Furancarboxylic acid can be synthesized through the oxidation of furfural or by the decarboxylation of 5-hydroxymethylfurfural. Its renewable and sustainable nature also positions it as a promising candidate for the development of bio-based materials and green chemicals, making it a versatile compound with extensive applications across the chemical industry.
Uses
Used in Pharmaceutical Industry:
2-Furancarboxylic acid is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of a wide range of medicinal compounds with potential health benefits.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Furancarboxylic acid serves as a precursor for the production of various agrochemicals, including pesticides and herbicides. Its role in these applications is crucial for enhancing crop protection and ensuring agricultural productivity.
Used in Organic Material Synthesis:
2-Furancarboxylic acid is utilized as a building block in the synthesis of organic materials, such as polymers and resins. Its incorporation into these materials can improve their properties, such as strength, durability, and resistance to environmental factors.
Used in Bio-based Materials Development:
Due to its renewable and sustainable nature, 2-Furancarboxylic acid is used in the development of bio-based materials, which are increasingly sought after as alternatives to petroleum-based products. These materials can be used in various industries, including packaging, textiles, and construction, to reduce environmental impact.
Used in Green Chemistry:
2-Furancarboxylic acid plays a significant role in green chemistry, where it is employed in the synthesis of environmentally friendly chemicals. Its use in this field helps to reduce the reliance on hazardous substances and promote sustainable chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 26447-28-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,4 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26447-28:
(7*2)+(6*6)+(5*4)+(4*4)+(3*7)+(2*2)+(1*8)=119
119 % 10 = 9
So 26447-28-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7)
C:Corrosive;
