26447-28-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Furancarboxylic acid is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of a wide range of medicinal compounds with potential health benefits.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Furancarboxylic acid serves as a precursor for the production of various agrochemicals, including pesticides and herbicides. Its role in these applications is crucial for enhancing crop protection and ensuring agricultural productivity.
Used in Organic Material Synthesis:
2-Furancarboxylic acid is utilized as a building block in the synthesis of organic materials, such as polymers and resins. Its incorporation into these materials can improve their properties, such as strength, durability, and resistance to environmental factors.
Used in Bio-based Materials Development:
Due to its renewable and sustainable nature, 2-Furancarboxylic acid is used in the development of bio-based materials, which are increasingly sought after as alternatives to petroleum-based products. These materials can be used in various industries, including packaging, textiles, and construction, to reduce environmental impact.
Used in Green Chemistry:
2-Furancarboxylic acid plays a significant role in green chemistry, where it is employed in the synthesis of environmentally friendly chemicals. Its use in this field helps to reduce the reliance on hazardous substances and promote sustainable chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 26447-28-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,4 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26447-28:
(7*2)+(6*6)+(5*4)+(4*4)+(3*7)+(2*2)+(1*8)=119
119 % 10 = 9
So 26447-28-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7)
C:Corrosive;
