23364-04-7 Usage
Description
AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is a chemical compound characterized by the molecular formula C8H13NO2. It is a cyclohexene derivative featuring an amino group and a carboxylic acid functional group. AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is widely utilized in medicinal chemistry and pharmaceutical research, serving as a key component in the development of potential drug candidates. Its ability to interact with specific biological targets makes it a valuable asset in the exploration of new therapeutic agents. Furthermore, its structural and chemical properties render it a versatile building block for synthesizing a range of organic compounds with potential pharmaceutical applications.
Uses
Used in Pharmaceutical Research:
AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is used as a key component in the development of potential drug candidates for various therapeutic applications. Its unique structure allows it to interact with specific biological targets, making it a valuable tool for investigating new treatment options.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is employed as a versatile building block for the synthesis of various organic compounds with potential pharmaceutical applications. Its chemical properties and functional groups enable the creation of diverse molecules that can be further optimized for specific therapeutic purposes.
Used in Drug Development:
AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is utilized in drug development as a starting material or intermediate in the synthesis of novel compounds with potential therapeutic effects. Its presence in these molecules can contribute to their biological activity, making it an essential component in the discovery and optimization of new drugs.
Used in Chemical Synthesis:
In the realm of chemical synthesis, AMINO-CYCLOHEX-3-ENYL-ACETIC ACID is employed as a versatile precursor for the creation of a wide range of organic compounds. Its unique structure and functional groups facilitate the formation of various molecular architectures, expanding the scope of synthetic chemistry and enabling the development of new compounds with potential applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 23364-04-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,3,6 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 23364-04:
(7*2)+(6*3)+(5*3)+(4*6)+(3*4)+(2*0)+(1*4)=87
87 % 10 = 7
So 23364-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,6-7H,3-5,9H2,(H,10,11)
