216393-64-5 Usage
Description
4-BROMO-2-FLUOROBENZENEBORONIC ACID is an organic compound that serves as a pharmaceutical intermediate. It is characterized by the presence of a boronic acid functional group and a bromo and fluoro substituent on the benzene ring, which contribute to its reactivity and potential applications in various chemical and pharmaceutical processes.
Uses
Used in Pharmaceutical Industry:
4-BROMO-2-FLUOROBENZENEBORONIC ACID is used as a pharmaceutical intermediate for the synthesis of various biologically active compounds. Its unique structure allows it to participate in cross-coupling reactions, which are essential for the development of new drugs and pharmaceuticals.
Used in Chemical Synthesis:
4-BROMO-2-FLUOROBENZENEBORONIC ACID is used as a reagent in chemical synthesis, particularly in cross-coupling reactions with arenediazonium tetrafluoroborates. These reactions are carried out in solvents such as dioxane or methanol and are catalyzed by palladium acetate in the absence of added base and phosphine ligand. The resulting products can be used in the development of new materials and compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 216393-64-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,6,3,9 and 3 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 216393-64:
(8*2)+(7*1)+(6*6)+(5*3)+(4*9)+(3*3)+(2*6)+(1*4)=135
135 % 10 = 5
So 216393-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H
