20737-41-1 Usage
Description
4-Aminopyrimidine-5-carboxylic acid is a pyrimidine derivative featuring an amino group and a carboxylic acid group. It serves as a crucial building block in the synthesis of pharmaceuticals and agrochemicals, playing a significant role in the development of various drugs and compounds. 4-AMINOPYRIMIDINE-5-CARBOXYLIC ACID has demonstrated potential antifungal and antimicrobial properties, making it a promising candidate for drug development. Furthermore, it has been studied for its applications in metal coordination chemistry, acting as a ligand in the formation of metal complexes. Its diverse chemical properties render it a valuable compound in organic chemistry and drug discovery.
Uses
Used in Pharmaceutical Industry:
4-Aminopyrimidine-5-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form essential drug structures and contribute to the development of new therapeutic agents.
Used in Agrochemical Industry:
4-AMINOPYRIMIDINE-5-CARBOXYLIC ACID is utilized as a building block in the production of agrochemicals, such as pesticides and herbicides, due to its potential to enhance the effectiveness of these chemicals in agricultural applications.
Used in Drug Development:
4-Aminopyrimidine-5-carboxylic acid is employed as a target for drug development, particularly for its potential antifungal and antimicrobial properties, which can lead to the creation of novel treatments for various infections and diseases.
Used in Metal Coordination Chemistry:
4-AMINOPYRIMIDINE-5-CARBOXYLIC ACID is used as a ligand in the formation of metal complexes, contributing to the advancement of metal coordination chemistry and the development of new materials with potential applications in various fields.
Used in Organic Chemistry Research:
4-Aminopyrimidine-5-carboxylic acid is utilized in organic chemistry research to explore its versatile chemical properties and investigate its potential applications in the synthesis of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 20737-41-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,7,3 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 20737-41:
(7*2)+(6*0)+(5*7)+(4*3)+(3*7)+(2*4)+(1*1)=91
91 % 10 = 1
So 20737-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-4-3(5(9)10)1-7-2-8-4/h1-2H,(H,9,10)(H2,6,7,8)
