19525-59-8 Usage
Description
N-Phenylglycine potassium salt is a chemical compound that is frequently utilized in pharmaceutical and chemical research. It is characterized by its strong nucleophilic properties, which enable it to donate electrons to other molecules in chemical reactions. The salt form is typically preferred due to its enhanced solubility, facilitating easier handling and storage. Its structural formula comprises a phenyl group attached to a glycine molecule, with a potassium counterion providing charge balance.
Uses
Used in Pharmaceutical Industry:
N-Phenylglycine potassium salt is used as an intermediate in the synthesis of various pharmaceutical drugs for its ability to participate in chemical reactions as a strong nucleophile.
Used in Chemical Research:
N-Phenylglycine potassium salt is used as a reagent in chemical research to study its nucleophilic properties and its interactions with other molecules in different reaction conditions.
Safety Precautions:
N-Phenylglycine potassium salt should be handled with caution, as exposure may pose certain risks. It is recommended to use appropriate safety gear during its handling and storage to minimize potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 19525-59-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,5,2 and 5 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 19525-59:
(7*1)+(6*9)+(5*5)+(4*2)+(3*5)+(2*5)+(1*9)=128
128 % 10 = 8
So 19525-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2.K/c10-8(11)6-9-7-4-2-1-3-5-7;/h1-5,9H,6H2,(H,10,11);/q;+1/p-1
