176779-14-9 Usage
Description
(R)-Benzyl 3-aminobutyrate, also known as (R)-B3A, is a chiral molecule belonging to the class of benzyl esters. It is an enantiomer of benzyl 3-aminobutyrate and is primarily used as a key intermediate for the synthesis of various pharmaceutical compounds. Its chiral nature makes it an important molecule in the production of chiral drugs and pharmaceutical research and development.
Uses
Used in Pharmaceutical Industry:
(R)-Benzyl 3-aminobutyrate is used as a key intermediate for the synthesis of various pharmaceutical compounds, particularly chiral drugs. Its unique chiral properties allow for the development of drugs with specific therapeutic effects and reduced side effects.
Used in Neurological Disorders Treatment:
(R)-Benzyl 3-aminobutyrate is used as a potential treatment for neurological disorders due to its promising potential as a neurotransmitter modulator. Its ability to modulate neurotransmitter activity can help in the management and treatment of various neurological conditions.
Used in Pharmaceutical Research and Development:
(R)-Benzyl 3-aminobutyrate is used as an important molecule in pharmaceutical research and development. Its unique properties and potential applications make it a valuable compound for the discovery and development of new drugs and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 176779-14-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,6,7,7 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 176779-14:
(8*1)+(7*7)+(6*6)+(5*7)+(4*7)+(3*9)+(2*1)+(1*4)=189
189 % 10 = 9
So 176779-14-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2/c1-9(12)7-11(13)14-8-10-5-3-2-4-6-10/h2-6,9H,7-8,12H2,1H3/t9-/m1/s1
