175277-93-7 Usage
Description
2-Amino-6-fluorobenzylamine, a chemical compound with the molecular formula C7H8FN, is a derivative of benzylamine featuring a fluorine atom attached to the 6th carbon of the benzene ring. 2-AMINO-6-FLUOROBENZYLAMINE is known for its potential applications in the pharmaceutical industry and organic chemistry, as well as its biological and pharmacological activities that are still under investigation.
Uses
Used in Pharmaceutical Industry:
2-Amino-6-fluorobenzylamine is used as a synthetic intermediate for the development of various drugs and medications. Its unique structure allows for the creation of complex organic molecules that can be tailored for specific therapeutic purposes.
Used in Organic Chemistry:
In the realm of organic chemistry, 2-amino-6-fluorobenzylamine serves as a key component in the preparation of intricate organic molecules. Its presence can influence the reactivity and selectivity of chemical reactions, making it a valuable asset in the synthesis of advanced organic compounds.
Used in Biological and Pharmacological Research:
2-Amino-6-fluorobenzylamine is also utilized in research settings to explore its potential biological and pharmacological properties. While further studies are required to fully comprehend its capabilities, it holds promise for contributing to the discovery of new therapeutic agents and understanding molecular interactions within biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-93-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175277-93:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*9)+(1*3)=167
167 % 10 = 7
So 175277-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H9FN2/c8-6-2-1-3-7(10)5(6)4-9/h1-3H,4,9-10H2