17249-00-2 Usage
Uses
Used in Pharmaceutical Industry:
LACCAIC ACID B is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure and functional groups may allow for interactions with specific biological targets, making it a promising candidate for the development of new drugs or drug delivery systems.
Used in Chemical Industry:
LACCAIC ACID B can be utilized as a chemical intermediate or building block in the synthesis of various complex organic molecules. Its tetrahydroxyanthraquinone core and functional groups can be further modified to create novel compounds with specific properties and applications.
Used in Dye Industry:
As a component of the LAC dye, LACCAIC ACID B contributes to the overall color and properties of the dye mixture. It can be used in the production of textiles, paints, and other materials that require coloration, taking advantage of its unique chemical structure to achieve specific color characteristics.
Used in Research and Development:
LACCAIC ACID B's unique structure and properties make it an interesting subject for research and development in various scientific fields. It can be studied to better understand its interactions with biological systems, its potential applications in drug discovery, or its use in the development of new materials and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 17249-00-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,2,4 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 17249-00:
(7*1)+(6*7)+(5*2)+(4*4)+(3*9)+(2*0)+(1*0)=102
102 % 10 = 2
So 17249-00-2 is a valid CAS Registry Number.
InChI:InChI=1/C24H16O12/c25-4-3-7-1-2-10(26)8(5-7)13-20(30)17-16(22(32)21(13)31)18(28)9-6-11(27)14(23(33)34)15(24(35)36)12(9)19(17)29/h1-2,5-6,25-27,30-32H,3-4H2,(H,33,34)(H,35,36)