170900-30-8 Usage
Description
5-[6,11-dihydroxy-11-[5-(1-hydroxytridecyl)oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one is a complex organic compound that belongs to the oxolanone class. It features a long hydrocarbon chain with multiple hydroxyl groups, and its structure includes two oxolan rings. One of these rings has a side chain with a hydroxytridecyl group, while the other is connected to a 2-oxopropyl group. The unique structure and functional groups of this molecule may offer a range of potential applications across different industries.
Uses
Used in Chemical Synthesis Industry:
5-[6,11-dihydroxy-11-[5-(1-hydroxytridecyl)oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one is used as a key intermediate in the synthesis of various complex organic compounds. Its unique structure and functional groups make it a valuable building block for creating novel molecules with specific properties and applications.
Used in Pharmaceutical Industry:
5-[6,11-dihydroxy-11-[5-(1-hydroxytridecyl)oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one is used as a potential pharmaceutical candidate for the development of new drugs. Its hydroxyl and oxolanone groups can be exploited for interactions with biological targets, offering opportunities for the treatment of various diseases and conditions.
Used in Cosmetics Industry:
5-[6,11-dihydroxy-11-[5-(1-hydroxytridecyl)oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one is used as an active ingredient in cosmetic formulations. Its hydroxyl groups can contribute to the moisturizing and emollient properties of skincare products, while its unique structure may provide additional benefits such as antioxidant or anti-aging effects.
Used in Material Science:
5-[6,11-dihydroxy-11-[5-(1-hydroxytridecyl)oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one is used in the development of advanced materials with specific properties. Its hydrocarbon chain and functional groups can be utilized to create polymers, coatings, or other materials with tailored characteristics for various applications, such as improved durability, thermal stability, or self-healing properties.
Used in Nanotechnology:
5-[6,11-dihydroxy-11-[5-(1-hydroxytridecyl)oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one is used in the design and synthesis of nanomaterials with unique properties. Its hydroxyl and oxolanone groups can be employed for the functionalization of nanoparticles, enabling their integration into various systems for applications in drug delivery, sensing, or energy storage.
Check Digit Verification of cas no
The CAS Registry Mumber 170900-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,0,9,0 and 0 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 170900-30:
(8*1)+(7*7)+(6*0)+(5*9)+(4*0)+(3*0)+(2*3)+(1*0)=108
108 % 10 = 8
So 170900-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C35H64O7/c1-3-4-5-6-7-8-9-10-11-15-21-31(38)33-23-24-34(42-33)32(39)22-17-16-19-29(37)18-13-12-14-20-30-26-28(25-27(2)36)35(40)41-30/h28-34,37-39H,3-26H2,1-2H3