1708-99-2 Usage
General Description
3-Methyl-3-penten-1-ol is a colorless liquid organic compound with the chemical formula C6H12O. It is commonly used as a flavoring agent and fragrance in various products. The compound is an alcohol, making it polar and capable of forming hydrogen bonds. It has a fruity and floral odor, with a hint of citrus notes. 3-Methyl-3-penten-1-ol is primarily used in the production of perfumes, cosmetics, and food flavorings, due to its pleasant aroma and ability to enhance the overall scent profile of the products. Additionally, it is utilized in the synthesis of other organic compounds and has potential applications in the pharmaceutical industry. Overall, this chemical serves as a versatile ingredient in various industries due to its unique fragrance and polar nature.
Check Digit Verification of cas no
The CAS Registry Mumber 1708-99-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,0 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1708-99:
(6*1)+(5*7)+(4*0)+(3*8)+(2*9)+(1*9)=92
92 % 10 = 2
So 1708-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H12O/c1-3-6(2)4-5-7/h3,7H,4-5H2,1-2H3/b6-3+
